C31H36F2N2O2 — CID 70263076
2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine (PubChem CID 70263076) has the molecular formula C31H36F2N2O2 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine.
| Compound Name | 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine |
|---|---|
| PubChem CID | 70263076 |
| Molecular Formula | C31H36F2N2O2 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine |
| SMILES | C=CCOc1ccc(-c2ccc(-c3ncc(C=CCCCC(C)OCCCCC)cn3)cc2)c(F)c1F |
| InChI | InChI=1S/C31H36F2N2O2/c1-4-6-10-20-36-23(3)11-8-7-9-12-24-21-34-31(35-22-24)26-15-13-25(14-16-26)27-17-18-28(37-19-5-2)30(33)29(27)32/h5,9,12-18,21-23H,2,4,6-8,10-11,19-20H2,1,3H3 |
| InChIKey | CRGOPBHVBULEIJ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|