C31H36F2N2O — CID 70265047
2-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine (PubChem CID 70265047) has the molecular formula C31H36F2N2O and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine.
| Compound Name | 2-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine |
|---|---|
| PubChem CID | 70265047 |
| Molecular Formula | C31H36F2N2O |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-prop-2-enylphenyl)phenyl]-5-(6-pentoxyhept-1-enyl)pyrimidine |
| SMILES | C=CCc1ccc(-c2ccc(-c3ncc(C=CCCCC(C)OCCCCC)cn3)cc2)c(F)c1F |
| InChI | InChI=1S/C31H36F2N2O/c1-4-6-10-20-36-23(3)12-8-7-9-13-24-21-34-31(35-22-24)27-16-14-25(15-17-27)28-19-18-26(11-5-2)29(32)30(28)33/h5,9,13-19,21-23H,2,4,6-8,10-12,20H2,1,3H3 |
| InChIKey | AMBXRBUAZIFTNL-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|