C30H34F2O2 — CID 70262779
2,3-difluoro-4-[4-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]phenol (PubChem CID 70262779) has the molecular formula C30H34F2O2 and a molecular weight of 464.60 g/mol. Its IUPAC name is 2,3-difluoro-4-[4-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]phenol.
| Compound Name | 2,3-difluoro-4-[4-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]phenol |
|---|---|
| PubChem CID | 70262779 |
| Molecular Formula | C30H34F2O2 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 2,3-difluoro-4-[4-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]phenyl]phenol |
| SMILES | CCCCCOC(C)CCC/C=C/c1ccc(-c2ccc(-c3ccc(O)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C30H34F2O2/c1-3-4-8-21-34-22(2)9-6-5-7-10-23-11-13-24(14-12-23)25-15-17-26(18-16-25)27-19-20-28(33)30(32)29(27)31/h7,10-20,22,33H,3-6,8-9,21H2,1-2H3/b10-7+ |
| InChIKey | QRSWWPWEIMOVLH-JXMROGBWSA-N |
| XLogP | 8.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|