C29H34FNO2 — CID 70264003
3-fluoro-4-[6-[4-(6-pentoxyhept-1-enyl)phenyl]-3-pyridinyl]phenol (PubChem CID 70264003) has the molecular formula C29H34FNO2 and a molecular weight of 447.59 g/mol. Its IUPAC name is 3-fluoro-4-[6-[4-(6-pentoxyhept-1-enyl)phenyl]-3-pyridinyl]phenol.
| Compound Name | 3-fluoro-4-[6-[4-(6-pentoxyhept-1-enyl)phenyl]-3-pyridinyl]phenol |
|---|---|
| PubChem CID | 70264003 |
| Molecular Formula | C29H34FNO2 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 3-fluoro-4-[6-[4-(6-pentoxyhept-1-enyl)phenyl]-3-pyridinyl]phenol |
| SMILES | CCCCCOC(C)CCCC=Cc1ccc(-c2ccc(-c3ccc(O)cc3F)cn2)cc1 |
| InChI | InChI=1S/C29H34FNO2/c1-3-4-8-19-33-22(2)9-6-5-7-10-23-11-13-24(14-12-23)29-18-15-25(21-31-29)27-17-16-26(32)20-28(27)30/h7,10-18,20-22,32H,3-6,8-9,19H2,1-2H3 |
| InChIKey | UULOCHZCQZRCBF-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|