C27H33NO2 — CID 70263304
3-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]isoquinolin-7-ol (PubChem CID 70263304) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 3-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]isoquinolin-7-ol.
| Compound Name | 3-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 70263304 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 3-[4-[(E)-6-pentoxyhept-1-enyl]phenyl]isoquinolin-7-ol |
| SMILES | CCCCCOC(C)CCC/C=C/c1ccc(-c2cc3ccc(O)cc3cn2)cc1 |
| InChI | InChI=1S/C27H33NO2/c1-3-4-8-17-30-21(2)9-6-5-7-10-22-11-13-23(14-12-22)27-19-24-15-16-26(29)18-25(24)20-28-27/h7,10-16,18-21,29H,3-6,8-9,17H2,1-2H3/b10-7+ |
| InChIKey | OVILOBIHXCKYGZ-JXMROGBWSA-N |
| XLogP | 7.39 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|