C29H35NO2 — CID 70265196
4-[4-[6-(6-pentoxyhept-1-enyl)-3-pyridinyl]phenyl]phenol (PubChem CID 70265196) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is 4-[4-[6-(6-pentoxyhept-1-enyl)-3-pyridinyl]phenyl]phenol.
| Compound Name | 4-[4-[6-(6-pentoxyhept-1-enyl)-3-pyridinyl]phenyl]phenol |
|---|---|
| PubChem CID | 70265196 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 4-[4-[6-(6-pentoxyhept-1-enyl)-3-pyridinyl]phenyl]phenol |
| SMILES | CCCCCOC(C)CCCC=Cc1ccc(-c2ccc(-c3ccc(O)cc3)cc2)cn1 |
| InChI | InChI=1S/C29H35NO2/c1-3-4-8-21-32-23(2)9-6-5-7-10-28-18-15-27(22-30-28)26-13-11-24(12-14-26)25-16-19-29(31)20-17-25/h7,10-20,22-23,31H,3-6,8-9,21H2,1-2H3 |
| InChIKey | DGSCQMGYQKJPGY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|