C28H34N2O2 — CID 173288690
4-[5-[4-(6-pentoxyhept-1-enyl)phenyl]pyrazin-2-yl]phenol (PubChem CID 173288690) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 4-[5-[4-(6-pentoxyhept-1-enyl)phenyl]pyrazin-2-yl]phenol.
| Compound Name | 4-[5-[4-(6-pentoxyhept-1-enyl)phenyl]pyrazin-2-yl]phenol |
|---|---|
| PubChem CID | 173288690 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 4-[5-[4-(6-pentoxyhept-1-enyl)phenyl]pyrazin-2-yl]phenol |
| SMILES | CCCCCOC(C)CCCC=Cc1ccc(-c2cnc(-c3ccc(O)cc3)cn2)cc1 |
| InChI | InChI=1S/C28H34N2O2/c1-3-4-8-19-32-22(2)9-6-5-7-10-23-11-13-24(14-12-23)27-20-30-28(21-29-27)25-15-17-26(31)18-16-25/h7,10-18,20-22,31H,3-6,8-9,19H2,1-2H3 |
| InChIKey | NITYJEMJPRCNJM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|