C23H30FNO2 — CID 173288698
3-fluoro-4-[5-(6-pentoxyhept-1-enyl)-2-pyridinyl]phenol (PubChem CID 173288698) has the molecular formula C23H30FNO2 and a molecular weight of 371.50 g/mol. Its IUPAC name is 3-fluoro-4-[5-(6-pentoxyhept-1-enyl)-2-pyridinyl]phenol.
| Compound Name | 3-fluoro-4-[5-(6-pentoxyhept-1-enyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 173288698 |
| Molecular Formula | C23H30FNO2 |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | 3-fluoro-4-[5-(6-pentoxyhept-1-enyl)-2-pyridinyl]phenol |
| SMILES | CCCCCOC(C)CCCC=Cc1ccc(-c2ccc(O)cc2F)nc1 |
| InChI | InChI=1S/C23H30FNO2/c1-3-4-8-15-27-18(2)9-6-5-7-10-19-11-14-23(25-17-19)21-13-12-20(26)16-22(21)24/h7,10-14,16-18,26H,3-6,8-9,15H2,1-2H3 |
| InChIKey | IKYQRUBLJLPAPJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|