C32H38FNO — CID 70260749
2-[4-(3-fluoro-4-prop-2-enylphenyl)phenyl]-5-[(E)-6-pentoxyhept-1-enyl]pyridine (PubChem CID 70260749) has the molecular formula C32H38FNO and a molecular weight of 471.66 g/mol. Its IUPAC name is 2-[4-(3-fluoro-4-prop-2-enylphenyl)phenyl]-5-[(E)-6-pentoxyhept-1-enyl]pyridine.
| Compound Name | 2-[4-(3-fluoro-4-prop-2-enylphenyl)phenyl]-5-[(E)-6-pentoxyhept-1-enyl]pyridine |
|---|---|
| PubChem CID | 70260749 |
| Molecular Formula | C32H38FNO |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | 2-[4-(3-fluoro-4-prop-2-enylphenyl)phenyl]-5-[(E)-6-pentoxyhept-1-enyl]pyridine |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(/C=C/CCCC(C)OCCCCC)cn3)cc2)cc1F |
| InChI | InChI=1S/C32H38FNO/c1-4-6-10-22-35-25(3)12-8-7-9-13-26-14-21-32(34-24-26)29-18-15-27(16-19-29)30-20-17-28(11-5-2)31(33)23-30/h5,9,13-21,23-25H,2,4,6-8,10-12,22H2,1,3H3/b13-9+ |
| InChIKey | NBKYXGUJYROLRR-UKTHLTGXSA-N |
| XLogP | 9.06 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|