C33H39FO — CID 70265065
2-fluoro-1-[(E)-6-pentoxyhept-1-enyl]-4-[4-(4-prop-2-enylphenyl)phenyl]benzene (PubChem CID 70265065) has the molecular formula C33H39FO and a molecular weight of 470.67 g/mol. Its IUPAC name is 2-fluoro-1-[(E)-6-pentoxyhept-1-enyl]-4-[4-(4-prop-2-enylphenyl)phenyl]benzene.
| Compound Name | 2-fluoro-1-[(E)-6-pentoxyhept-1-enyl]-4-[4-(4-prop-2-enylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 70265065 |
| Molecular Formula | C33H39FO |
| Molecular Weight | 470.67 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 2-fluoro-1-[(E)-6-pentoxyhept-1-enyl]-4-[4-(4-prop-2-enylphenyl)phenyl]benzene |
| SMILES | C=CCc1ccc(-c2ccc(-c3ccc(/C=C/CCCC(C)OCCCCC)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C33H39FO/c1-4-6-10-24-35-26(3)12-8-7-9-13-31-22-23-32(25-33(31)34)30-20-18-29(19-21-30)28-16-14-27(11-5-2)15-17-28/h5,9,13-23,25-26H,2,4,6-8,10-12,24H2,1,3H3/b13-9+ |
| InChIKey | FZPDKAYVQKWLRO-UKTHLTGXSA-N |
| XLogP | 9.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.67 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|