C30H36FNO — CID 70264415
2-[2-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylquinoline (PubChem CID 70264415) has the molecular formula C30H36FNO and a molecular weight of 445.62 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylquinoline.
| Compound Name | 2-[2-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylquinoline |
|---|---|
| PubChem CID | 70264415 |
| Molecular Formula | C30H36FNO |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | 2-[2-fluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylquinoline |
| SMILES | C=CCc1ccc2nc(-c3ccc(/C=C/CCCC(C)OCCCCC)cc3F)ccc2c1 |
| InChI | InChI=1S/C30H36FNO/c1-4-6-10-20-33-23(3)12-8-7-9-13-25-14-17-27(28(31)22-25)30-19-16-26-21-24(11-5-2)15-18-29(26)32-30/h5,9,13-19,21-23H,2,4,6-8,10-12,20H2,1,3H3/b13-9+ |
| InChIKey | XBBUCYGYBZFWBE-UKTHLTGXSA-N |
| XLogP | 8.55 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|