C31H36F2O — CID 70265121
2-[2,3-difluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylnaphthalene (PubChem CID 70265121) has the molecular formula C31H36F2O and a molecular weight of 462.62 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylnaphthalene.
| Compound Name | 2-[2,3-difluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylnaphthalene |
|---|---|
| PubChem CID | 70265121 |
| Molecular Formula | C31H36F2O |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | 2-[2,3-difluoro-4-[(E)-6-pentoxyhept-1-enyl]phenyl]-6-prop-2-enylnaphthalene |
| SMILES | C=CCc1ccc2cc(-c3ccc(/C=C/CCCC(C)OCCCCC)c(F)c3F)ccc2c1 |
| InChI | InChI=1S/C31H36F2O/c1-4-6-10-20-34-23(3)12-8-7-9-13-25-18-19-29(31(33)30(25)32)28-17-16-26-21-24(11-5-2)14-15-27(26)22-28/h5,9,13-19,21-23H,2,4,6-8,10-12,20H2,1,3H3/b13-9+ |
| InChIKey | FTIHUOBAWKFCHA-UKTHLTGXSA-N |
| XLogP | 9.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|