C25H32F2N2O2 — CID 70264027
5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine (PubChem CID 70264027) has the molecular formula C25H32F2N2O2 and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine.
| Compound Name | 5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine |
|---|---|
| PubChem CID | 70264027 |
| Molecular Formula | C25H32F2N2O2 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 5-(2,3-difluoro-4-prop-2-enoxyphenyl)-2-(6-pentoxyhept-1-enyl)pyrimidine |
| SMILES | C=CCOc1ccc(-c2cnc(C=CCCCC(C)OCCCCC)nc2)c(F)c1F |
| InChI | InChI=1S/C25H32F2N2O2/c1-4-6-10-16-30-19(3)11-8-7-9-12-23-28-17-20(18-29-23)21-13-14-22(31-15-5-2)25(27)24(21)26/h5,9,12-14,17-19H,2,4,6-8,10-11,15-16H2,1,3H3 |
| InChIKey | YMSZYEWJQFQKOC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|