C20H24N2O — CID 70263354
(E)-7-[5-(4-prop-2-enylphenyl)pyrimidin-2-yl]hept-6-en-2-ol (PubChem CID 70263354) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (E)-7-[5-(4-prop-2-enylphenyl)pyrimidin-2-yl]hept-6-en-2-ol.
| Compound Name | (E)-7-[5-(4-prop-2-enylphenyl)pyrimidin-2-yl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263354 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (E)-7-[5-(4-prop-2-enylphenyl)pyrimidin-2-yl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc(-c2cnc(/C=C/CCCC(C)O)nc2)cc1 |
| InChI | InChI=1S/C20H24N2O/c1-3-7-17-10-12-18(13-11-17)19-14-21-20(22-15-19)9-6-4-5-8-16(2)23/h3,6,9-16,23H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | XBBJOYWBBRGNEO-RMKNXTFCSA-N |
| XLogP | 4.44 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|