C25H27NO — CID 70263664
(E)-7-[5-(6-prop-2-enylnaphthalen-2-yl)-2-pyridinyl]hept-6-en-2-ol (PubChem CID 70263664) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (E)-7-[5-(6-prop-2-enylnaphthalen-2-yl)-2-pyridinyl]hept-6-en-2-ol.
| Compound Name | (E)-7-[5-(6-prop-2-enylnaphthalen-2-yl)-2-pyridinyl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 70263664 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (E)-7-[5-(6-prop-2-enylnaphthalen-2-yl)-2-pyridinyl]hept-6-en-2-ol |
| SMILES | C=CCc1ccc2cc(-c3ccc(/C=C/CCCC(C)O)nc3)ccc2c1 |
| InChI | InChI=1S/C25H27NO/c1-3-7-20-10-11-22-17-23(13-12-21(22)16-20)24-14-15-25(26-18-24)9-6-4-5-8-19(2)27/h3,6,9-19,27H,1,4-5,7-8H2,2H3/b9-6+ |
| InChIKey | BLLLIGLEPRYFLA-RMKNXTFCSA-N |
| XLogP | 6.19 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|