C17H30O — CID 143867256
ethane;(E,2R)-6-(3-methylphenyl)hex-5-en-2-ol (PubChem CID 143867256) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;(E,2R)-6-(3-methylphenyl)hex-5-en-2-ol.
| Compound Name | ethane;(E,2R)-6-(3-methylphenyl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 143867256 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | ethane;(E,2R)-6-(3-methylphenyl)hex-5-en-2-ol |
| SMILES | CC.CC.Cc1cccc(/C=C/CC[C@@H](C)O)c1 |
| InChI | InChI=1S/C13H18O.2C2H6/c1-11-6-5-9-13(10-11)8-4-3-7-12(2)14;2*1-2/h4-6,8-10,12,14H,3,7H2,1-2H3;2*1-2H3/b8-4+;;/t12-;;/m1../s1 |
| InChIKey | KKJAOXWFPAUIFJ-LFDVWUTOSA-N |
| XLogP | 5.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |