About 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine
1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine (PubChem CID 143443436) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine.
Molecular Properties
| Compound Name | 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine |
| PubChem CID | 143443436 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine |
| SMILES | C=CN.CC.CC/C=C/c1cccc(C)c1 |
| InChI | InChI=1S/C11H14.C2H5N.C2H6/c1-3-4-7-11-8-5-6-10(2)9-11;1-2-3;1-2/h4-9H,3H2,1-2H3;2H,1,3H2;1-2H3/b7-4+;; |
| InChIKey | RPNFOJDNQGTLEW-RDRKJGRWSA-N |
| XLogP | 4.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine?
The IUPAC name of 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine (CID 143443436) is 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine.
What is the SMILES notation for 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine?
The canonical SMILES for 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine is C=CN.CC.CC/C=C/c1cccc(C)c1.
What is the InChIKey of 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine?
The InChIKey is RPNFOJDNQGTLEW-RDRKJGRWSA-N. The full InChI is InChI=1S/C11H14.C2H5N.C2H6/c1-3-4-7-11-8-5-6-10(2)9-11;1-2-3;1-2/h4-9H,3H2,1-2H3;2H,1,3H2;1-2H3/b7-4+;;.
What are the key properties of 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine?
1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine has a molecular weight of 219.37 g/mol, XLogP of 4.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-but-1-enyl]-3-methylbenzene;ethane;ethenamine is sourced from PubChem (CID 143443436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).