C11H12 — CID 129406214
1-[(1Z)-buta-1,3-dienyl]-3-methylbenzene (PubChem CID 129406214) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-3-methylbenzene.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-3-methylbenzene |
|---|---|
| PubChem CID | 129406214 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-3-methylbenzene |
| SMILES | C=C/C=C\c1cccc(C)c1 |
| InChI | InChI=1S/C11H12/c1-3-4-7-11-8-5-6-10(2)9-11/h3-9H,1H2,2H3/b7-4- |
| InChIKey | IFFZIWFIIZSRQE-DAXSKMNVSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|