About 3-[(1Z)-buta-1,3-dienyl]benzaldehyde
3-[(1Z)-buta-1,3-dienyl]benzaldehyde (PubChem CID 45083985) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]benzaldehyde.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]benzaldehyde |
| PubChem CID | 45083985 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]benzaldehyde |
| SMILES | C=C/C=C\c1cccc(C=O)c1 |
| InChI | InChI=1S/C11H10O/c1-2-3-5-10-6-4-7-11(8-10)9-12/h2-9H,1H2/b5-3- |
| InChIKey | SBYMTSUZXZRCHG-HYXAFXHYSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]benzaldehyde?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]benzaldehyde (CID 45083985) is 3-[(1Z)-buta-1,3-dienyl]benzaldehyde.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]benzaldehyde?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]benzaldehyde is C=C/C=C\c1cccc(C=O)c1.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]benzaldehyde?
The InChIKey is SBYMTSUZXZRCHG-HYXAFXHYSA-N. The full InChI is InChI=1S/C11H10O/c1-2-3-5-10-6-4-7-11(8-10)9-12/h2-9H,1H2/b5-3-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]benzaldehyde?
3-[(1Z)-buta-1,3-dienyl]benzaldehyde has a molecular weight of 158.20 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]benzaldehyde is sourced from PubChem (CID 45083985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).