About benzene-1,3-dicarbaldehyde;ethane
benzene-1,3-dicarbaldehyde;ethane (PubChem CID 91375977) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is benzene-1,3-dicarbaldehyde;ethane.
Molecular Properties
| Compound Name | benzene-1,3-dicarbaldehyde;ethane |
| PubChem CID | 91375977 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | benzene-1,3-dicarbaldehyde;ethane |
| SMILES | CC.O=Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C8H6O2.C2H6/c9-5-7-2-1-3-8(4-7)6-10;1-2/h1-6H;1-2H3 |
| InChIKey | IVASEBSCESWFMN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-dicarbaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-dicarbaldehyde;ethane?
The IUPAC name of benzene-1,3-dicarbaldehyde;ethane (CID 91375977) is benzene-1,3-dicarbaldehyde;ethane.
What is the SMILES notation for benzene-1,3-dicarbaldehyde;ethane?
The canonical SMILES for benzene-1,3-dicarbaldehyde;ethane is CC.O=Cc1cccc(C=O)c1.
What is the InChIKey of benzene-1,3-dicarbaldehyde;ethane?
The InChIKey is IVASEBSCESWFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.C2H6/c9-5-7-2-1-3-8(4-7)6-10;1-2/h1-6H;1-2H3.
What are the key properties of benzene-1,3-dicarbaldehyde;ethane?
benzene-1,3-dicarbaldehyde;ethane has a molecular weight of 164.20 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-dicarbaldehyde;ethane is sourced from PubChem (CID 91375977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).