About benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole)
benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) (PubChem CID 174923777) has the molecular formula C24H26N4O2
and a molecular weight of 402.50 g/mol. Its IUPAC name is benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole).
Molecular Properties
| Compound Name | benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) |
| PubChem CID | 174923777 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) |
| SMILES | O=Cc1cccc(C=O)c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1 |
| InChI | InChI=1S/C8H6O2.4C4H5N/c9-5-7-2-1-3-8(4-7)6-10;4*1-2-4-5-3-1/h1-6H;4*1-5H |
| InChIKey | FZKIIZGCGUPIQW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole)?
The IUPAC name of benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) (CID 174923777) is benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole).
What is the SMILES notation for benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole)?
The canonical SMILES for benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) is O=Cc1cccc(C=O)c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.c1cc[nH]c1.
What is the InChIKey of benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole)?
The InChIKey is FZKIIZGCGUPIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2.4C4H5N/c9-5-7-2-1-3-8(4-7)6-10;4*1-2-4-5-3-1/h1-6H;4*1-5H.
What are the key properties of benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole)?
benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) has a molecular weight of 402.50 g/mol, XLogP of 5.37, 2 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3-dicarbaldehyde;tetrakis(1H-pyrrole) is sourced from PubChem (CID 174923777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).