About 3-bromobenzaldehyde;hydrobromide
3-bromobenzaldehyde;hydrobromide (PubChem CID 87841856) has the molecular formula C7H6Br2O
and a molecular weight of 265.93 g/mol. Its IUPAC name is 3-bromobenzaldehyde;hydrobromide.
Molecular Properties
| Compound Name | 3-bromobenzaldehyde;hydrobromide |
| PubChem CID | 87841856 |
| Molecular Formula | C7H6Br2O |
| Molecular Weight | 265.93 g/mol |
| Exact Mass | 263.88 |
| IUPAC Name | 3-bromobenzaldehyde;hydrobromide |
| SMILES | Br.O=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C7H5BrO.BrH/c8-7-3-1-2-6(4-7)5-9;/h1-5H;1H |
| InChIKey | FURFVPBUGLPPFW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.93 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-bromobenzaldehyde;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromobenzaldehyde;hydrobromide?
The IUPAC name of 3-bromobenzaldehyde;hydrobromide (CID 87841856) is 3-bromobenzaldehyde;hydrobromide.
What is the SMILES notation for 3-bromobenzaldehyde;hydrobromide?
The canonical SMILES for 3-bromobenzaldehyde;hydrobromide is Br.O=Cc1cccc(Br)c1.
What is the InChIKey of 3-bromobenzaldehyde;hydrobromide?
The InChIKey is FURFVPBUGLPPFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO.BrH/c8-7-3-1-2-6(4-7)5-9;/h1-5H;1H.
What are the key properties of 3-bromobenzaldehyde;hydrobromide?
3-bromobenzaldehyde;hydrobromide has a molecular weight of 265.93 g/mol, XLogP of 2.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromobenzaldehyde;hydrobromide is sourced from PubChem (CID 87841856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).