C8H5BrF2 — CID 11356427
1-bromo-3-(2,2-difluoroethenyl)benzene (PubChem CID 11356427) has the molecular formula C8H5BrF2 and a molecular weight of 219.03 g/mol. Its IUPAC name is 1-bromo-3-(2,2-difluoroethenyl)benzene.
| Compound Name | 1-bromo-3-(2,2-difluoroethenyl)benzene |
|---|---|
| PubChem CID | 11356427 |
| Molecular Formula | C8H5BrF2 |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 217.95 |
| IUPAC Name | 1-bromo-3-(2,2-difluoroethenyl)benzene |
| SMILES | FC(F)=Cc1cccc(Br)c1 |
| InChI | InChI=1S/C8H5BrF2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-5H |
| InChIKey | BCGPNQGFMONPMI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |