C10H6Br2F2 — CID 125476830
1,3-bis[(E)-2-bromo-2-fluoroethenyl]benzene (PubChem CID 125476830) has the molecular formula C10H6Br2F2 and a molecular weight of 323.96 g/mol. Its IUPAC name is 1,3-bis[(E)-2-bromo-2-fluoroethenyl]benzene.
| Compound Name | 1,3-bis[(E)-2-bromo-2-fluoroethenyl]benzene |
|---|---|
| PubChem CID | 125476830 |
| Molecular Formula | C10H6Br2F2 |
| Molecular Weight | 323.96 g/mol |
| Exact Mass | 321.88 |
| IUPAC Name | 1,3-bis[(E)-2-bromo-2-fluoroethenyl]benzene |
| SMILES | F/C(Br)=C\c1cccc(/C=C(\F)Br)c1 |
| InChI | InChI=1S/C10H6Br2F2/c11-9(13)5-7-2-1-3-8(4-7)6-10(12)14/h1-6H/b9-5-,10-6- |
| InChIKey | JVOVAYWLIFOJNQ-OZDSWYPASA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |