About 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene
1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene (PubChem CID 165485333) has the molecular formula C9H5F5
and a molecular weight of 208.13 g/mol. Its IUPAC name is 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene.
Analyze 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene?
The IUPAC name of 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene (CID 165485333) is 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene.
What is the SMILES notation for 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene?
The canonical SMILES for 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene is F/C(=C/c1cccc(F)c1)C(F)(F)F.
What is the InChIKey of 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene?
The InChIKey is WXZVMAYTXGBHFS-VMPITWQZSA-N. The full InChI is InChI=1S/C9H5F5/c10-7-3-1-2-6(4-7)5-8(11)9(12,13)14/h1-5H/b8-5+.
What are the key properties of 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene?
1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene has a molecular weight of 208.13 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3-[(E)-2,3,3,3-tetrafluoroprop-1-enyl]benzene is sourced from PubChem (CID 165485333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).