C13H15FO2 — CID 87902667
(2Z)-2-[(3-fluorophenyl)methylidene]-3,3-dimethylbutanoic acid (PubChem CID 87902667) has the molecular formula C13H15FO2 and a molecular weight of 222.26 g/mol. Its IUPAC name is (2Z)-2-[(3-fluorophenyl)methylidene]-3,3-dimethylbutanoic acid.
| Compound Name | (2Z)-2-[(3-fluorophenyl)methylidene]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87902667 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2Z)-2-[(3-fluorophenyl)methylidene]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)/C(=C/c1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C13H15FO2/c1-13(2,3)11(12(15)16)8-9-5-4-6-10(14)7-9/h4-8H,1-3H3,(H,15,16)/b11-8+ |
| InChIKey | CDRVOKJQHISTKK-DHZHZOJOSA-N |
| XLogP | 3.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|