C21H24O3 — CID 70130981
2-benzylidene-3,3-dimethylbutanoic acid;2-phenylethenol (PubChem CID 70130981) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-benzylidene-3,3-dimethylbutanoic acid;2-phenylethenol.
| Compound Name | 2-benzylidene-3,3-dimethylbutanoic acid;2-phenylethenol |
|---|---|
| PubChem CID | 70130981 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-benzylidene-3,3-dimethylbutanoic acid;2-phenylethenol |
| SMILES | CC(C)(C)C(=Cc1ccccc1)C(=O)O.OC=Cc1ccccc1 |
| InChI | InChI=1S/C13H16O2.C8H8O/c1-13(2,3)11(12(14)15)9-10-7-5-4-6-8-10;9-7-6-8-4-2-1-3-5-8/h4-9H,1-3H3,(H,14,15);1-7,9H |
| InChIKey | GBCKXMGLWSAKCI-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|