C14H19NO — CID 150998431
N-(3-benzylidene-4,4-dimethylpentan-2-ylidene)hydroxylamine (PubChem CID 150998431) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(3-benzylidene-4,4-dimethylpentan-2-ylidene)hydroxylamine.
| Compound Name | N-(3-benzylidene-4,4-dimethylpentan-2-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 150998431 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-(3-benzylidene-4,4-dimethylpentan-2-ylidene)hydroxylamine |
| SMILES | CC(=NO)C(=Cc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C14H19NO/c1-11(15-16)13(14(2,3)4)10-12-8-6-5-7-9-12/h5-10,16H,1-4H3 |
| InChIKey | LTPCDIKKIOFCQL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|