C16H15NO — CID 12637252
(NE)-N-[(Z)-3,4-diphenylbut-3-en-2-ylidene]hydroxylamine (PubChem CID 12637252) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (NE)-N-[(Z)-3,4-diphenylbut-3-en-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(Z)-3,4-diphenylbut-3-en-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 12637252 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (NE)-N-[(Z)-3,4-diphenylbut-3-en-2-ylidene]hydroxylamine |
| SMILES | CC(=N\O)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H15NO/c1-13(17-18)16(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-12,18H,1H3/b16-12+,17-13+ |
| InChIKey | DEKOOXQBPCOQQX-UNZYHPAISA-N |
| XLogP | 4.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|