C19H17N — CID 135010938
(2Z,4E)-2,3-dimethyl-4,5-diphenylpenta-2,4-dienenitrile (PubChem CID 135010938) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is (2Z,4E)-2,3-dimethyl-4,5-diphenylpenta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2,3-dimethyl-4,5-diphenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 135010938 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2Z,4E)-2,3-dimethyl-4,5-diphenylpenta-2,4-dienenitrile |
| SMILES | C/C(C#N)=C(C)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N/c1-15(14-20)16(2)19(18-11-7-4-8-12-18)13-17-9-5-3-6-10-17/h3-13H,1-2H3/b16-15-,19-13- |
| InChIKey | FMZUFNUFENQYDY-RHPWFBRESA-N |
| XLogP | 5.09 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|