About 4-phenylhexa-2,4-dien-3-ylbenzene
4-phenylhexa-2,4-dien-3-ylbenzene (PubChem CID 2802592) has the molecular formula C18H18
and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-phenylhexa-2,4-dien-3-ylbenzene.
Molecular Properties
| Compound Name | 4-phenylhexa-2,4-dien-3-ylbenzene |
| PubChem CID | 2802592 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4-phenylhexa-2,4-dien-3-ylbenzene |
| SMILES | CC=C(C(=CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16/h3-14H,1-2H3 |
| InChIKey | VTUNKULRSRAFHV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylhexa-2,4-dien-3-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylhexa-2,4-dien-3-ylbenzene?
The IUPAC name of 4-phenylhexa-2,4-dien-3-ylbenzene (CID 2802592) is 4-phenylhexa-2,4-dien-3-ylbenzene.
What is the SMILES notation for 4-phenylhexa-2,4-dien-3-ylbenzene?
The canonical SMILES for 4-phenylhexa-2,4-dien-3-ylbenzene is CC=C(C(=CC)c1ccccc1)c1ccccc1.
What is the InChIKey of 4-phenylhexa-2,4-dien-3-ylbenzene?
The InChIKey is VTUNKULRSRAFHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18/c1-3-17(15-11-7-5-8-12-15)18(4-2)16-13-9-6-10-14-16/h3-14H,1-2H3.
What are the key properties of 4-phenylhexa-2,4-dien-3-ylbenzene?
4-phenylhexa-2,4-dien-3-ylbenzene has a molecular weight of 234.34 g/mol, XLogP of 5.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylhexa-2,4-dien-3-ylbenzene is sourced from PubChem (CID 2802592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).