About ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene
ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene (PubChem CID 143592596) has the molecular formula C20H24
and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene.
Molecular Properties
| Compound Name | ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene |
| PubChem CID | 143592596 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene |
| SMILES | C=C(/C(=C\C)c1ccccc1)c1ccccc1C.CC |
| InChI | InChI=1S/C18H18.C2H6/c1-4-17(16-11-6-5-7-12-16)15(3)18-13-9-8-10-14(18)2;1-2/h4-13H,3H2,1-2H3;1-2H3/b17-4+; |
| InChIKey | LHVWYBUTYUPNBE-DBYAPITPSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene?
The IUPAC name of ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene (CID 143592596) is ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene.
What is the SMILES notation for ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene?
The canonical SMILES for ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene is C=C(/C(=C\C)c1ccccc1)c1ccccc1C.CC.
What is the InChIKey of ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene?
The InChIKey is LHVWYBUTYUPNBE-DBYAPITPSA-N. The full InChI is InChI=1S/C18H18.C2H6/c1-4-17(16-11-6-5-7-12-16)15(3)18-13-9-8-10-14(18)2;1-2/h4-13H,3H2,1-2H3;1-2H3/b17-4+;.
What are the key properties of ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene?
ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene has a molecular weight of 264.41 g/mol, XLogP of 6.14, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-2-[(3Z)-3-phenylpenta-1,3-dien-2-yl]benzene is sourced from PubChem (CID 143592596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).