C16H14 — CID 11171770
1-methyl-2-(1-phenylpropa-1,2-dienyl)benzene (PubChem CID 11171770) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-methyl-2-(1-phenylpropa-1,2-dienyl)benzene.
| Compound Name | 1-methyl-2-(1-phenylpropa-1,2-dienyl)benzene |
|---|---|
| PubChem CID | 11171770 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-methyl-2-(1-phenylpropa-1,2-dienyl)benzene |
| SMILES | C=C=C(c1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C16H14/c1-3-15(14-10-5-4-6-11-14)16-12-8-7-9-13(16)2/h4-12H,1H2,2H3 |
| InChIKey | XXNQZUUHBUOONH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |