C21H20 — CID 101122268
1-hex-1-ynyl-2-(1-phenylpropa-1,2-dienyl)benzene (PubChem CID 101122268) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-hex-1-ynyl-2-(1-phenylpropa-1,2-dienyl)benzene.
| Compound Name | 1-hex-1-ynyl-2-(1-phenylpropa-1,2-dienyl)benzene |
|---|---|
| PubChem CID | 101122268 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-hex-1-ynyl-2-(1-phenylpropa-1,2-dienyl)benzene |
| SMILES | C=C=C(c1ccccc1)c1ccccc1C#CCCCC |
| InChI | InChI=1S/C21H20/c1-3-5-6-8-15-19-16-11-12-17-21(19)20(4-2)18-13-9-7-10-14-18/h7,9-14,16-17H,2-3,5-6H2,1H3 |
| InChIKey | XKQMZVYDIOPLDQ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|