2-pent-1-ynylbenzoic acid

C12H12O2 — CID 10419975

IUPAC2-pent-1-ynylbenzoic acid
SMILESCCCC#Cc1ccccc1C(=O)O
InChIInChI=1S/C12H12O2/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14/h5-6,8-9H,2-3H2,1H3,(H,13,14)
InChIKeyUJVKVNDYFKXMOC-UHFFFAOYSA-N
MW188.23 g/mol
LogP2.54
Rot. Bonds2

About 2-pent-1-ynylbenzoic acid

2-pent-1-ynylbenzoic acid (PubChem CID 10419975) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-pent-1-ynylbenzoic acid.

Molecular Properties

Compound Name2-pent-1-ynylbenzoic acid
PubChem CID10419975
Molecular FormulaC12H12O2
Molecular Weight188.23 g/mol
Exact Mass188.08
IUPAC Name2-pent-1-ynylbenzoic acid
SMILESCCCC#Cc1ccccc1C(=O)O
InChIInChI=1S/C12H12O2/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14/h5-6,8-9H,2-3H2,1H3,(H,13,14)
InChIKeyUJVKVNDYFKXMOC-UHFFFAOYSA-N
XLogP2.54
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.23
LogP ≤ 52.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-pent-1-ynylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pent-1-ynylbenzoic acid?
The IUPAC name of 2-pent-1-ynylbenzoic acid (CID 10419975) is 2-pent-1-ynylbenzoic acid.
What is the SMILES notation for 2-pent-1-ynylbenzoic acid?
The canonical SMILES for 2-pent-1-ynylbenzoic acid is CCCC#Cc1ccccc1C(=O)O.
What is the InChIKey of 2-pent-1-ynylbenzoic acid?
The InChIKey is UJVKVNDYFKXMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14/h5-6,8-9H,2-3H2,1H3,(H,13,14).
What are the key properties of 2-pent-1-ynylbenzoic acid?
2-pent-1-ynylbenzoic acid has a molecular weight of 188.23 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-1-ynylbenzoic acid is sourced from PubChem (CID 10419975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).