About 2-pent-1-ynylbenzoic acid
2-pent-1-ynylbenzoic acid (PubChem CID 10419975) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-pent-1-ynylbenzoic acid.
Molecular Properties
| Compound Name | 2-pent-1-ynylbenzoic acid |
| PubChem CID | 10419975 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-pent-1-ynylbenzoic acid |
| SMILES | CCCC#Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C12H12O2/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14/h5-6,8-9H,2-3H2,1H3,(H,13,14) |
| InChIKey | UJVKVNDYFKXMOC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-1-ynylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-1-ynylbenzoic acid?
The IUPAC name of 2-pent-1-ynylbenzoic acid (CID 10419975) is 2-pent-1-ynylbenzoic acid.
What is the SMILES notation for 2-pent-1-ynylbenzoic acid?
The canonical SMILES for 2-pent-1-ynylbenzoic acid is CCCC#Cc1ccccc1C(=O)O.
What is the InChIKey of 2-pent-1-ynylbenzoic acid?
The InChIKey is UJVKVNDYFKXMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-3-4-7-10-8-5-6-9-11(10)12(13)14/h5-6,8-9H,2-3H2,1H3,(H,13,14).
What are the key properties of 2-pent-1-ynylbenzoic acid?
2-pent-1-ynylbenzoic acid has a molecular weight of 188.23 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-1-ynylbenzoic acid is sourced from PubChem (CID 10419975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).