C10H9NO2 — CID 67117343
2-(3-aminoprop-1-ynyl)benzoic acid (PubChem CID 67117343) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is 2-(3-aminoprop-1-ynyl)benzoic acid.
| Compound Name | 2-(3-aminoprop-1-ynyl)benzoic acid |
|---|---|
| PubChem CID | 67117343 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-(3-aminoprop-1-ynyl)benzoic acid |
| SMILES | NCC#Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C10H9NO2/c11-7-3-5-8-4-1-2-6-9(8)10(12)13/h1-2,4,6H,7,11H2,(H,12,13) |
| InChIKey | NAAOELIQWKCSHY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|