About 2-hex-1-ynylbenzoyl chloride
2-hex-1-ynylbenzoyl chloride (PubChem CID 10727684) has the molecular formula C13H13ClO
and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-hex-1-ynylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-hex-1-ynylbenzoyl chloride |
| PubChem CID | 10727684 |
| Molecular Formula | C13H13ClO |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-hex-1-ynylbenzoyl chloride |
| SMILES | CCCCC#Cc1ccccc1C(=O)Cl |
| InChI | InChI=1S/C13H13ClO/c1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15/h6-7,9-10H,2-4H2,1H3 |
| InChIKey | OWHCEBUSBDMMHH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-1-ynylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-1-ynylbenzoyl chloride?
The IUPAC name of 2-hex-1-ynylbenzoyl chloride (CID 10727684) is 2-hex-1-ynylbenzoyl chloride.
What is the SMILES notation for 2-hex-1-ynylbenzoyl chloride?
The canonical SMILES for 2-hex-1-ynylbenzoyl chloride is CCCCC#Cc1ccccc1C(=O)Cl.
What is the InChIKey of 2-hex-1-ynylbenzoyl chloride?
The InChIKey is OWHCEBUSBDMMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO/c1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15/h6-7,9-10H,2-4H2,1H3.
What are the key properties of 2-hex-1-ynylbenzoyl chloride?
2-hex-1-ynylbenzoyl chloride has a molecular weight of 220.70 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-1-ynylbenzoyl chloride is sourced from PubChem (CID 10727684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).