2-hex-1-ynylbenzoyl chloride

C13H13ClO — CID 10727684

IUPAC2-hex-1-ynylbenzoyl chloride
SMILESCCCCC#Cc1ccccc1C(=O)Cl
InChIInChI=1S/C13H13ClO/c1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15/h6-7,9-10H,2-4H2,1H3
InChIKeyOWHCEBUSBDMMHH-UHFFFAOYSA-N
MW220.70 g/mol
LogP3.61
Rot. Bonds3

About 2-hex-1-ynylbenzoyl chloride

2-hex-1-ynylbenzoyl chloride (PubChem CID 10727684) has the molecular formula C13H13ClO and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-hex-1-ynylbenzoyl chloride.

Molecular Properties

Compound Name2-hex-1-ynylbenzoyl chloride
PubChem CID10727684
Molecular FormulaC13H13ClO
Molecular Weight220.70 g/mol
Exact Mass220.07
IUPAC Name2-hex-1-ynylbenzoyl chloride
SMILESCCCCC#Cc1ccccc1C(=O)Cl
InChIInChI=1S/C13H13ClO/c1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15/h6-7,9-10H,2-4H2,1H3
InChIKeyOWHCEBUSBDMMHH-UHFFFAOYSA-N
XLogP3.61
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.70
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-hex-1-ynylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hex-1-ynylbenzoyl chloride?
The IUPAC name of 2-hex-1-ynylbenzoyl chloride (CID 10727684) is 2-hex-1-ynylbenzoyl chloride.
What is the SMILES notation for 2-hex-1-ynylbenzoyl chloride?
The canonical SMILES for 2-hex-1-ynylbenzoyl chloride is CCCCC#Cc1ccccc1C(=O)Cl.
What is the InChIKey of 2-hex-1-ynylbenzoyl chloride?
The InChIKey is OWHCEBUSBDMMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO/c1-2-3-4-5-8-11-9-6-7-10-12(11)13(14)15/h6-7,9-10H,2-4H2,1H3.
What are the key properties of 2-hex-1-ynylbenzoyl chloride?
2-hex-1-ynylbenzoyl chloride has a molecular weight of 220.70 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-1-ynylbenzoyl chloride is sourced from PubChem (CID 10727684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).