About 1-hex-1-ynylnaphthalene
1-hex-1-ynylnaphthalene (PubChem CID 11769709) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-hex-1-ynylnaphthalene.
Molecular Properties
| Compound Name | 1-hex-1-ynylnaphthalene |
| PubChem CID | 11769709 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-hex-1-ynylnaphthalene |
| SMILES | CCCCC#Cc1cccc2ccccc12 |
| InChI | InChI=1S/C16H16/c1-2-3-4-5-9-14-11-8-12-15-10-6-7-13-16(14)15/h6-8,10-13H,2-4H2,1H3 |
| InChIKey | BFFQDUOVMHMYIK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hex-1-ynylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hex-1-ynylnaphthalene?
The IUPAC name of 1-hex-1-ynylnaphthalene (CID 11769709) is 1-hex-1-ynylnaphthalene.
What is the SMILES notation for 1-hex-1-ynylnaphthalene?
The canonical SMILES for 1-hex-1-ynylnaphthalene is CCCCC#Cc1cccc2ccccc12.
What is the InChIKey of 1-hex-1-ynylnaphthalene?
The InChIKey is BFFQDUOVMHMYIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16/c1-2-3-4-5-9-14-11-8-12-15-10-6-7-13-16(14)15/h6-8,10-13H,2-4H2,1H3.
What are the key properties of 1-hex-1-ynylnaphthalene?
1-hex-1-ynylnaphthalene has a molecular weight of 208.30 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hex-1-ynylnaphthalene is sourced from PubChem (CID 11769709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).