About [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate
[(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate (PubChem CID 139261689) has the molecular formula C23H24O2
and a molecular weight of 332.44 g/mol. Its IUPAC name is [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate.
Molecular Properties
| Compound Name | [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate |
| PubChem CID | 139261689 |
| Molecular Formula | C23H24O2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate |
| SMILES | CCCCC#Cc1ccccc1C(=O)OC/C=C/Cc1ccccc1 |
| InChI | InChI=1S/C23H24O2/c1-2-3-4-8-16-21-17-9-10-18-22(21)23(24)25-19-12-11-15-20-13-6-5-7-14-20/h5-7,9-14,17-18H,2-4,15,19H2,1H3/b12-11+ |
| InChIKey | BPUJCDLFXIZXLK-VAWYXSNFSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate?
The IUPAC name of [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate (CID 139261689) is [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate.
What is the SMILES notation for [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate?
The canonical SMILES for [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate is CCCCC#Cc1ccccc1C(=O)OC/C=C/Cc1ccccc1.
What is the InChIKey of [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate?
The InChIKey is BPUJCDLFXIZXLK-VAWYXSNFSA-N. The full InChI is InChI=1S/C23H24O2/c1-2-3-4-8-16-21-17-9-10-18-22(21)23(24)25-19-12-11-15-20-13-6-5-7-14-20/h5-7,9-14,17-18H,2-4,15,19H2,1H3/b12-11+.
What are the key properties of [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate?
[(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate has a molecular weight of 332.44 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-phenylbut-2-enyl] 2-hex-1-ynylbenzoate is sourced from PubChem (CID 139261689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).