C12H11ClO2 — CID 170468019
3-(4-chlorobut-1-ynyl)-2-methylbenzoic acid (PubChem CID 170468019) has the molecular formula C12H11ClO2 and a molecular weight of 222.67 g/mol. Its IUPAC name is 3-(4-chlorobut-1-ynyl)-2-methylbenzoic acid.
| Compound Name | 3-(4-chlorobut-1-ynyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 170468019 |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 3-(4-chlorobut-1-ynyl)-2-methylbenzoic acid |
| SMILES | Cc1c(C#CCCCl)cccc1C(=O)O |
| InChI | InChI=1S/C12H11ClO2/c1-9-10(5-2-3-8-13)6-4-7-11(9)12(14)15/h4,6-7H,3,8H2,1H3,(H,14,15) |
| InChIKey | AFHFQISUVYYHFS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|