C27H20 — CID 15621535
1,3,3-triphenyl(1,2,3-13C3)propa-1,2-dienylbenzene (PubChem CID 15621535) has the molecular formula C27H20 and a molecular weight of 347.43 g/mol. Its IUPAC name is 1,3,3-triphenyl(1,2,3-13C3)propa-1,2-dienylbenzene.
| Compound Name | 1,3,3-triphenyl(1,2,3-13C3)propa-1,2-dienylbenzene |
|---|---|
| PubChem CID | 15621535 |
| Molecular Formula | C27H20 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1,3,3-triphenyl(1,2,3-13C3)propa-1,2-dienylbenzene |
| SMILES | c1ccc([13C](=[13C]=[13C](c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20/c1-5-13-22(14-6-1)26(23-15-7-2-8-16-23)21-27(24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H/i21+1,26+1,27+1 |
| InChIKey | IFDRDSWHWMTLKM-ACPAPWEQSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |