C14H12O2 — CID 11012436
(Z)-1,2-diphenylethene-1,2-diol (PubChem CID 11012436) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (Z)-1,2-diphenylethene-1,2-diol.
| Compound Name | (Z)-1,2-diphenylethene-1,2-diol |
|---|---|
| PubChem CID | 11012436 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (Z)-1,2-diphenylethene-1,2-diol |
| SMILES | O/C(=C(\O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,15-16H/b14-13- |
| InChIKey | IEVIXDLZSRLUHW-YPKPFQOOSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|