C10H12O2 — CID 131346173
(Z)-2-methyl-1-phenylprop-1-ene-1,3-diol (PubChem CID 131346173) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (Z)-2-methyl-1-phenylprop-1-ene-1,3-diol.
| Compound Name | (Z)-2-methyl-1-phenylprop-1-ene-1,3-diol |
|---|---|
| PubChem CID | 131346173 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (Z)-2-methyl-1-phenylprop-1-ene-1,3-diol |
| SMILES | C/C(CO)=C(/O)c1ccccc1 |
| InChI | InChI=1S/C10H12O2/c1-8(7-11)10(12)9-5-3-2-4-6-9/h2-6,11-12H,7H2,1H3/b10-8- |
| InChIKey | QDXUUQVDLNALLM-NTMALXAHSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|