C16H16O — CID 91085638
2,3-diphenylbut-2-en-1-ol (PubChem CID 91085638) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is 2,3-diphenylbut-2-en-1-ol.
| Compound Name | 2,3-diphenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 91085638 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2,3-diphenylbut-2-en-1-ol |
| SMILES | CC(=C(CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O/c1-13(14-8-4-2-5-9-14)16(12-17)15-10-6-3-7-11-15/h2-11,17H,12H2,1H3 |
| InChIKey | WRBLZWIAVBFKCB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|