C13H16O — CID 16751532
(2E)-2-methyl-3-phenylhexa-2,5-dien-1-ol (PubChem CID 16751532) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is (2E)-2-methyl-3-phenylhexa-2,5-dien-1-ol.
| Compound Name | (2E)-2-methyl-3-phenylhexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 16751532 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2E)-2-methyl-3-phenylhexa-2,5-dien-1-ol |
| SMILES | C=CC/C(=C(/C)CO)c1ccccc1 |
| InChI | InChI=1S/C13H16O/c1-3-7-13(11(2)10-14)12-8-5-4-6-9-12/h3-6,8-9,14H,1,7,10H2,2H3/b13-11+ |
| InChIKey | SAZZMELMMZXRHV-ACCUITESSA-N |
| XLogP | 3.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|