About azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride
azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride (PubChem CID 174764098) has the molecular formula C14H22ClN
and a molecular weight of 239.79 g/mol. Its IUPAC name is azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride.
Molecular Properties
| Compound Name | azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride |
| PubChem CID | 174764098 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride |
| SMILES | C=CCC(=C(C)C)c1ccc(C)cc1.Cl.N |
| InChI | InChI=1S/C14H18.ClH.H3N/c1-5-6-14(11(2)3)13-9-7-12(4)8-10-13;;/h5,7-10H,1,6H2,2-4H3;1H;1H3 |
| InChIKey | HSCJEHPMZXOEOV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride?
The IUPAC name of azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride (CID 174764098) is azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride.
What is the SMILES notation for azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride?
The canonical SMILES for azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride is C=CCC(=C(C)C)c1ccc(C)cc1.Cl.N.
What is the InChIKey of azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride?
The InChIKey is HSCJEHPMZXOEOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18.ClH.H3N/c1-5-6-14(11(2)3)13-9-7-12(4)8-10-13;;/h5,7-10H,1,6H2,2-4H3;1H;1H3.
What are the key properties of azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride?
azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride has a molecular weight of 239.79 g/mol, XLogP of 4.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-methyl-4-(2-methylhexa-2,5-dien-3-yl)benzene;hydrochloride is sourced from PubChem (CID 174764098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).