C21H26 — CID 145212384
1-methyl-4-[4-[(2E)-penta-2,4-dien-2-yl]phenyl]benzene;propane (PubChem CID 145212384) has the molecular formula C21H26 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-methyl-4-[4-[(2E)-penta-2,4-dien-2-yl]phenyl]benzene;propane.
| Compound Name | 1-methyl-4-[4-[(2E)-penta-2,4-dien-2-yl]phenyl]benzene;propane |
|---|---|
| PubChem CID | 145212384 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-methyl-4-[4-[(2E)-penta-2,4-dien-2-yl]phenyl]benzene;propane |
| SMILES | C=C/C=C(\C)c1ccc(-c2ccc(C)cc2)cc1.CCC |
| InChI | InChI=1S/C18H18.C3H8/c1-4-5-15(3)16-10-12-18(13-11-16)17-8-6-14(2)7-9-17;1-3-2/h4-13H,1H2,2-3H3;3H2,1-2H3/b15-5+; |
| InChIKey | ZVBGJBHAHPBVCH-GBDQXREISA-N |
| XLogP | 6.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|