C15H20 — CID 123525800
1-butyl-4-penta-2,4-dien-2-ylbenzene (PubChem CID 123525800) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 1-butyl-4-penta-2,4-dien-2-ylbenzene.
| Compound Name | 1-butyl-4-penta-2,4-dien-2-ylbenzene |
|---|---|
| PubChem CID | 123525800 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 1-butyl-4-penta-2,4-dien-2-ylbenzene |
| SMILES | C=CC=C(C)c1ccc(CCCC)cc1 |
| InChI | InChI=1S/C15H20/c1-4-6-8-14-9-11-15(12-10-14)13(3)7-5-2/h5,7,9-12H,2,4,6,8H2,1,3H3 |
| InChIKey | FXXJVVKJHOHKEG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|