About CID 69445910
CID 69445910 (PubChem CID 69445910) has the molecular formula C22H28AlO4
and a molecular weight of 383.44 g/mol.
Molecular Properties
| Compound Name | CID 69445910 |
| PubChem CID | 69445910 |
| Molecular Formula | C22H28AlO4 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | — |
| SMILES | CCCCc1ccc(C(=O)O)cc1.CCCCc1ccc(C(=O)O)cc1.[Al] |
| InChI | InChI=1S/2C11H14O2.Al/c2*1-2-3-4-9-5-7-10(8-6-9)11(12)13;/h2*5-8H,2-4H2,1H3,(H,12,13); |
| InChIKey | FUVJBMQAOZSLIJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 69445910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 69445910?
The IUPAC name of CID 69445910 (CID 69445910) is not available.
What is the SMILES notation for CID 69445910?
The canonical SMILES for CID 69445910 is CCCCc1ccc(C(=O)O)cc1.CCCCc1ccc(C(=O)O)cc1.[Al].
What is the InChIKey of CID 69445910?
The InChIKey is FUVJBMQAOZSLIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H14O2.Al/c2*1-2-3-4-9-5-7-10(8-6-9)11(12)13;/h2*5-8H,2-4H2,1H3,(H,12,13);.
What are the key properties of CID 69445910?
CID 69445910 has a molecular weight of 383.44 g/mol, XLogP of 5.07, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 69445910 is sourced from PubChem (CID 69445910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).