About ethane;4-propylbenzoic acid
ethane;4-propylbenzoic acid (PubChem CID 91047964) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is ethane;4-propylbenzoic acid.
Molecular Properties
| Compound Name | ethane;4-propylbenzoic acid |
| PubChem CID | 91047964 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | ethane;4-propylbenzoic acid |
| SMILES | CC.CCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C10H12O2.C2H6/c1-2-3-8-4-6-9(7-5-8)10(11)12;1-2/h4-7H,2-3H2,1H3,(H,11,12);1-2H3 |
| InChIKey | CSMQBIIZLRNQRS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-propylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-propylbenzoic acid?
The IUPAC name of ethane;4-propylbenzoic acid (CID 91047964) is ethane;4-propylbenzoic acid.
What is the SMILES notation for ethane;4-propylbenzoic acid?
The canonical SMILES for ethane;4-propylbenzoic acid is CC.CCCc1ccc(C(=O)O)cc1.
What is the InChIKey of ethane;4-propylbenzoic acid?
The InChIKey is CSMQBIIZLRNQRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2.C2H6/c1-2-3-8-4-6-9(7-5-8)10(11)12;1-2/h4-7H,2-3H2,1H3,(H,11,12);1-2H3.
What are the key properties of ethane;4-propylbenzoic acid?
ethane;4-propylbenzoic acid has a molecular weight of 194.27 g/mol, XLogP of 3.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-propylbenzoic acid is sourced from PubChem (CID 91047964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).